C17H26N2O3 — CID 90293198
2-(morpholin-4-ylmethyl)-5-(piperidin-1-ylmethyl)benzene-1,4-diol (PubChem CID 90293198) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-5-(piperidin-1-ylmethyl)benzene-1,4-diol.
| Compound Name | 2-(morpholin-4-ylmethyl)-5-(piperidin-1-ylmethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 90293198 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-5-(piperidin-1-ylmethyl)benzene-1,4-diol |
| SMILES | Oc1cc(CN2CCOCC2)c(O)cc1CN1CCCCC1 |
| InChI | InChI=1S/C17H26N2O3/c20-16-11-15(13-19-6-8-22-9-7-19)17(21)10-14(16)12-18-4-2-1-3-5-18/h10-11,20-21H,1-9,12-13H2 |
| InChIKey | GMPNJKNWZWWUQC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|