C19H30N2O2 — CID 60526509
4,5-dimethyl-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]phenol (PubChem CID 60526509) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4,5-dimethyl-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]phenol.
| Compound Name | 4,5-dimethyl-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 60526509 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 4,5-dimethyl-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]phenol |
| SMILES | Cc1cc(O)c(CN2CCC(CN3CCOCC3)CC2)cc1C |
| InChI | InChI=1S/C19H30N2O2/c1-15-11-18(19(22)12-16(15)2)14-20-5-3-17(4-6-20)13-21-7-9-23-10-8-21/h11-12,17,22H,3-10,13-14H2,1-2H3 |
| InChIKey | HVGLFDAJMAEHDO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|