C33H58N2O11 — CID 10462009
4-methyl-2,6-bis(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)phenol (PubChem CID 10462009) has the molecular formula C33H58N2O11 and a molecular weight of 658.83 g/mol. Its IUPAC name is 4-methyl-2,6-bis(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)phenol.
| Compound Name | 4-methyl-2,6-bis(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)phenol |
|---|---|
| PubChem CID | 10462009 |
| Molecular Formula | C33H58N2O11 |
| Molecular Weight | 658.83 g/mol |
| Exact Mass | 658.40 |
| IUPAC Name | 4-methyl-2,6-bis(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)phenol |
| SMILES | Cc1cc(CN2CCOCCOCCOCCOCCOCC2)c(O)c(CN2CCOCCOCCOCCOCCOCC2)c1 |
| InChI | InChI=1S/C33H58N2O11/c1-30-26-31(28-34-2-6-37-10-14-41-18-22-45-23-19-42-15-11-38-7-3-34)33(36)32(27-30)29-35-4-8-39-12-16-43-20-24-46-25-21-44-17-13-40-9-5-35/h26-27,36H,2-25,28-29H2,1H3 |
| InChIKey | MQUYPYQFYAZPJC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.83 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|