C21H34N4O4 — CID 139658917
3-amino-2,4,6-tris(morpholin-4-ylmethyl)phenol (PubChem CID 139658917) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-amino-2,4,6-tris(morpholin-4-ylmethyl)phenol.
| Compound Name | 3-amino-2,4,6-tris(morpholin-4-ylmethyl)phenol |
|---|---|
| PubChem CID | 139658917 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 3-amino-2,4,6-tris(morpholin-4-ylmethyl)phenol |
| SMILES | Nc1c(CN2CCOCC2)cc(CN2CCOCC2)c(O)c1CN1CCOCC1 |
| InChI | InChI=1S/C21H34N4O4/c22-20-17(14-23-1-7-27-8-2-23)13-18(15-24-3-9-28-10-4-24)21(26)19(20)16-25-5-11-29-12-6-25/h13,26H,1-12,14-16,22H2 |
| InChIKey | OYIOYYOVTHTPHA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|