C22H35N3O4 — CID 144964322
2,4-bis(morpholin-4-ylmethyl)-6-(1,4-oxazepan-4-ylmethyl)phenol (PubChem CID 144964322) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2,4-bis(morpholin-4-ylmethyl)-6-(1,4-oxazepan-4-ylmethyl)phenol.
| Compound Name | 2,4-bis(morpholin-4-ylmethyl)-6-(1,4-oxazepan-4-ylmethyl)phenol |
|---|---|
| PubChem CID | 144964322 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2,4-bis(morpholin-4-ylmethyl)-6-(1,4-oxazepan-4-ylmethyl)phenol |
| SMILES | Oc1c(CN2CCCOCC2)cc(CN2CCOCC2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C22H35N3O4/c26-22-20(17-23-2-1-8-27-9-3-23)14-19(16-24-4-10-28-11-5-24)15-21(22)18-25-6-12-29-13-7-25/h14-15,26H,1-13,16-18H2 |
| InChIKey | OVZGKOUYUHHKTH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|