C28H44N4O6 — CID 10578190
2-amino-6-[[16-[(3-amino-2-hydroxy-5-methylphenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-methylphenol (PubChem CID 10578190) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is 2-amino-6-[[16-[(3-amino-2-hydroxy-5-methylphenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-methylphenol.
| Compound Name | 2-amino-6-[[16-[(3-amino-2-hydroxy-5-methylphenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 10578190 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | 2-amino-6-[[16-[(3-amino-2-hydroxy-5-methylphenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-methylphenol |
| SMILES | Cc1cc(N)c(O)c(CN2CCOCCOCCN(Cc3cc(C)cc(N)c3O)CCOCCOCC2)c1 |
| InChI | InChI=1S/C28H44N4O6/c1-21-15-23(27(33)25(29)17-21)19-31-3-7-35-11-13-37-9-5-32(6-10-38-14-12-36-8-4-31)20-24-16-22(2)18-26(30)28(24)34/h15-18,33-34H,3-14,19-20,29-30H2,1-2H3 |
| InChIKey | VDZANTKHDHVSIQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|