C33H42N6O6 — CID 170744187
3-[[4,7-bis[(3-carbamoyl-2-hydroxy-5-methylphenyl)methyl]-1,4,7-triazonan-1-yl]methyl]-2-hydroxy-5-methylbenzamide (PubChem CID 170744187) has the molecular formula C33H42N6O6 and a molecular weight of 618.74 g/mol. Its IUPAC name is 3-[[4,7-bis[(3-carbamoyl-2-hydroxy-5-methylphenyl)methyl]-1,4,7-triazonan-1-yl]methyl]-2-hydroxy-5-methylbenzamide.
| Compound Name | 3-[[4,7-bis[(3-carbamoyl-2-hydroxy-5-methylphenyl)methyl]-1,4,7-triazonan-1-yl]methyl]-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 170744187 |
| Molecular Formula | C33H42N6O6 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 3-[[4,7-bis[(3-carbamoyl-2-hydroxy-5-methylphenyl)methyl]-1,4,7-triazonan-1-yl]methyl]-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1cc(CN2CCN(Cc3cc(C)cc(C(N)=O)c3O)CCN(Cc3cc(C)cc(C(N)=O)c3O)CC2)c(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C33H42N6O6/c1-19-10-22(28(40)25(13-19)31(34)43)16-37-4-6-38(17-23-11-20(2)14-26(29(23)41)32(35)44)8-9-39(7-5-37)18-24-12-21(3)15-27(30(24)42)33(36)45/h10-15,40-42H,4-9,16-18H2,1-3H3,(H2,34,43)(H2,35,44)(H2,36,45) |
| InChIKey | UHRCLSMPMPQIAD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 199.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|