C15H23N3S — CID 63335952
2-[4-[(2,5-dimethylphenyl)methyl]piperazin-1-yl]ethanethioamide (PubChem CID 63335952) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethylphenyl)methyl]piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-[(2,5-dimethylphenyl)methyl]piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 63335952 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-[4-[(2,5-dimethylphenyl)methyl]piperazin-1-yl]ethanethioamide |
| SMILES | Cc1ccc(C)c(CN2CCN(CC(N)=S)CC2)c1 |
| InChI | InChI=1S/C15H23N3S/c1-12-3-4-13(2)14(9-12)10-17-5-7-18(8-6-17)11-15(16)19/h3-4,9H,5-8,10-11H2,1-2H3,(H2,16,19) |
| InChIKey | ZBZVAERQGPBTFV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|