C21H25N3O2 — CID 167850936
4-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]benzamide (PubChem CID 167850936) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]benzamide.
| Compound Name | 4-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 167850936 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[4-[(2,5-dimethylphenyl)methyl]piperazine-1-carbonyl]benzamide |
| SMILES | Cc1ccc(C)c(CN2CCN(C(=O)c3ccc(C(N)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-3-4-16(2)19(13-15)14-23-9-11-24(12-10-23)21(26)18-7-5-17(6-8-18)20(22)25/h3-8,13H,9-12,14H2,1-2H3,(H2,22,25) |
| InChIKey | BFIDFUUQSLWGOR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |