C22H26N2O2 — CID 110366584
1-(2,5-dimethylphenyl)-2-[4-(4-methylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 110366584) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-[4-(4-methylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(2,5-dimethylphenyl)-2-[4-(4-methylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110366584 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-[4-(4-methylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C(=O)N2CCN(CC(=O)c3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-16-5-8-19(9-6-16)22(26)24-12-10-23(11-13-24)15-21(25)20-14-17(2)4-7-18(20)3/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | YHVJDJSBCGZTRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |