C17H25NO — CID 63622261
1-(2,5-dimethylphenyl)-2-(4-methylazepan-1-yl)ethanone (PubChem CID 63622261) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(4-methylazepan-1-yl)ethanone.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(4-methylazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 63622261 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(4-methylazepan-1-yl)ethanone |
| SMILES | Cc1ccc(C)c(C(=O)CN2CCCC(C)CC2)c1 |
| InChI | InChI=1S/C17H25NO/c1-13-5-4-9-18(10-8-13)12-17(19)16-11-14(2)6-7-15(16)3/h6-7,11,13H,4-5,8-10,12H2,1-3H3 |
| InChIKey | VKQOQIOKHGUUBA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |