C20H30BrNO7 — CID 100998969
5-bromo-2-hydroxy-3-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)benzaldehyde (PubChem CID 100998969) has the molecular formula C20H30BrNO7 and a molecular weight of 476.36 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-3-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)benzaldehyde.
| Compound Name | 5-bromo-2-hydroxy-3-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 100998969 |
| Molecular Formula | C20H30BrNO7 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 5-bromo-2-hydroxy-3-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)benzaldehyde |
| SMILES | O=Cc1cc(Br)cc(CN2CCOCCOCCOCCOCCOCC2)c1O |
| InChI | InChI=1S/C20H30BrNO7/c21-19-13-17(20(24)18(14-19)16-23)15-22-1-3-25-5-7-27-9-11-29-12-10-28-8-6-26-4-2-22/h13-14,16,24H,1-12,15H2 |
| InChIKey | BKAQYPAUMXLUOH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|