C12H16N2O3 — CID 63884770
4-(1,4-oxazepan-4-ylmethyl)pyridine-2-carboxylic acid (PubChem CID 63884770) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(1,4-oxazepan-4-ylmethyl)pyridine-2-carboxylic acid.
| Compound Name | 4-(1,4-oxazepan-4-ylmethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63884770 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-(1,4-oxazepan-4-ylmethyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(CN2CCCOCC2)ccn1 |
| InChI | InChI=1S/C12H16N2O3/c15-12(16)11-8-10(2-3-13-11)9-14-4-1-6-17-7-5-14/h2-3,8H,1,4-7,9H2,(H,15,16) |
| InChIKey | DFMVTKAAIQGGPL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |