C14H20N4OS — CID 63881119
4-[(4-acetyl-1,4-diazepan-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 63881119) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-[(4-acetyl-1,4-diazepan-1-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 4-[(4-acetyl-1,4-diazepan-1-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63881119 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-[(4-acetyl-1,4-diazepan-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CC(=O)N1CCCN(Cc2ccnc(C(N)=S)c2)CC1 |
| InChI | InChI=1S/C14H20N4OS/c1-11(19)18-6-2-5-17(7-8-18)10-12-3-4-16-13(9-12)14(15)20/h3-4,9H,2,5-8,10H2,1H3,(H2,15,20) |
| InChIKey | PVBFBHNIBSPMRA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|