C13H16N4O2S — CID 63881918
4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 63881918) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63881918 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CCN1CCN(Cc2ccnc(C(N)=S)c2)C(=O)C1=O |
| InChI | InChI=1S/C13H16N4O2S/c1-2-16-5-6-17(13(19)12(16)18)8-9-3-4-15-10(7-9)11(14)20/h3-4,7H,2,5-6,8H2,1H3,(H2,14,20) |
| InChIKey | WPUDRKDDAHRXGZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|