C14H22N4S — CID 63882888
4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]pyridine-2-carbothioamide (PubChem CID 63882888) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63882888 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]pyridine-2-carbothioamide |
| SMILES | CN(CCN1CCCC1)Cc1ccnc(C(N)=S)c1 |
| InChI | InChI=1S/C14H22N4S/c1-17(8-9-18-6-2-3-7-18)11-12-4-5-16-13(10-12)14(15)19/h4-5,10H,2-3,6-9,11H2,1H3,(H2,15,19) |
| InChIKey | BOQZQPGKMKKCSQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|