C14H14FN3S — CID 63883459
4-[(4-fluoro-N-methylanilino)methyl]pyridine-2-carbothioamide (PubChem CID 63883459) has the molecular formula C14H14FN3S and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[(4-fluoro-N-methylanilino)methyl]pyridine-2-carbothioamide.
| Compound Name | 4-[(4-fluoro-N-methylanilino)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63883459 |
| Molecular Formula | C14H14FN3S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-[(4-fluoro-N-methylanilino)methyl]pyridine-2-carbothioamide |
| SMILES | CN(Cc1ccnc(C(N)=S)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FN3S/c1-18(12-4-2-11(15)3-5-12)9-10-6-7-17-13(8-10)14(16)19/h2-8H,9H2,1H3,(H2,16,19) |
| InChIKey | HTSRLXLLGAVUDQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|