C15H26N4S — CID 63882102
4-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]pyridine-2-carbothioamide (PubChem CID 63882102) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 4-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63882102 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]pyridine-2-carbothioamide |
| SMILES | CC(C)CN(CCN(C)C)Cc1ccnc(C(N)=S)c1 |
| InChI | InChI=1S/C15H26N4S/c1-12(2)10-19(8-7-18(3)4)11-13-5-6-17-14(9-13)15(16)20/h5-6,9,12H,7-8,10-11H2,1-4H3,(H2,16,20) |
| InChIKey | FXSUUDILGNMAHU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|