C14H24ClN3 — CID 62472378
N'-[(2-chloro-4-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 62472378) has the molecular formula C14H24ClN3 and a molecular weight of 269.82 g/mol. Its IUPAC name is N'-[(2-chloro-4-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(2-chloro-4-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62472378 |
| Molecular Formula | C14H24ClN3 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N'-[(2-chloro-4-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN(C)C)Cc1ccnc(Cl)c1 |
| InChI | InChI=1S/C14H24ClN3/c1-12(2)10-18(8-7-17(3)4)11-13-5-6-16-14(15)9-13/h5-6,9,12H,7-8,10-11H2,1-4H3 |
| InChIKey | QXBWDRQOTDIBFJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|