C14H27N5 — CID 79259446
N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 79259446) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79259446 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN(C)C)Cc1cc(NN)ccn1 |
| InChI | InChI=1S/C14H27N5/c1-12(2)10-19(8-7-18(3)4)11-14-9-13(17-15)5-6-16-14/h5-6,9,12H,7-8,10-11,15H2,1-4H3,(H,16,17) |
| InChIKey | LYCFJEKEHWZKLF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|