C13H25N5 — CID 79259826
N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine (PubChem CID 79259826) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 79259826 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | N'-[(4-hydrazinyl-2-pyridinyl)methyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN(C)C)Cc1cc(NN)ccn1 |
| InChI | InChI=1S/C13H25N5/c1-4-7-18(9-8-17(2)3)11-13-10-12(16-14)5-6-15-13/h5-6,10H,4,7-9,11,14H2,1-3H3,(H,15,16) |
| InChIKey | LHGMLPFXXLUVCR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|