C10H15F3N4 — CID 79259080
N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinyl-2-pyridinyl)methyl]ethanamine (PubChem CID 79259080) has the molecular formula C10H15F3N4 and a molecular weight of 248.25 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinyl-2-pyridinyl)methyl]ethanamine.
| Compound Name | N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinyl-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 79259080 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinyl-2-pyridinyl)methyl]ethanamine |
| SMILES | CCN(Cc1cc(NN)ccn1)CC(F)(F)F |
| InChI | InChI=1S/C10H15F3N4/c1-2-17(7-10(11,12)13)6-9-5-8(16-14)3-4-15-9/h3-5H,2,6-7,14H2,1H3,(H,15,16) |
| InChIKey | HOQWLBCGZNNFBQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|