C9H11ClF2N2 — CID 115611804
N-[(2-chloro-4-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine (PubChem CID 115611804) has the molecular formula C9H11ClF2N2 and a molecular weight of 220.65 g/mol. Its IUPAC name is N-[(2-chloro-4-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine.
| Compound Name | N-[(2-chloro-4-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine |
|---|---|
| PubChem CID | 115611804 |
| Molecular Formula | C9H11ClF2N2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | N-[(2-chloro-4-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine |
| SMILES | CN(Cc1ccnc(Cl)c1)CC(F)F |
| InChI | InChI=1S/C9H11ClF2N2/c1-14(6-9(11)12)5-7-2-3-13-8(10)4-7/h2-4,9H,5-6H2,1H3 |
| InChIKey | DNMHQQRGLPFMRL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|