C10H14F2N2 — CID 60923207
3-[[2,2-difluoroethyl(methyl)amino]methyl]aniline (PubChem CID 60923207) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-[[2,2-difluoroethyl(methyl)amino]methyl]aniline.
| Compound Name | 3-[[2,2-difluoroethyl(methyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 60923207 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-[[2,2-difluoroethyl(methyl)amino]methyl]aniline |
| SMILES | CN(Cc1cccc(N)c1)CC(F)F |
| InChI | InChI=1S/C10H14F2N2/c1-14(7-10(11)12)6-8-3-2-4-9(13)5-8/h2-5,10H,6-7,13H2,1H3 |
| InChIKey | SYMKBSGCFORKOW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|