C11H15N2+ — CID 140706213
3-[[methyl(prop-2-enyl)amino]methyl]aniline (PubChem CID 140706213) has the molecular formula C11H15N2+ and a molecular weight of 175.25 g/mol. Its IUPAC name is 3-[[methyl(prop-2-enyl)amino]methyl]aniline.
| Compound Name | 3-[[methyl(prop-2-enyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 140706213 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3-[[methyl(prop-2-enyl)amino]methyl]aniline |
| SMILES | [H]/[C+]=C/CN(C)Cc1cccc(N)c1 |
| InChI | InChI=1S/C11H15N2/c1-3-7-13(2)9-10-5-4-6-11(12)8-10/h1,3-6,8H,7,9,12H2,2H3/q+1 |
| InChIKey | LXZSTCNGRBSJIL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|