C16H18F2N2 — CID 62196361
3-[[(2,4-difluorophenyl)methyl-ethylamino]methyl]aniline (PubChem CID 62196361) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-[[(2,4-difluorophenyl)methyl-ethylamino]methyl]aniline.
| Compound Name | 3-[[(2,4-difluorophenyl)methyl-ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 62196361 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-[[(2,4-difluorophenyl)methyl-ethylamino]methyl]aniline |
| SMILES | CCN(Cc1cccc(N)c1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H18F2N2/c1-2-20(10-12-4-3-5-15(19)8-12)11-13-6-7-14(17)9-16(13)18/h3-9H,2,10-11,19H2,1H3 |
| InChIKey | QFCWHMCMAPXKGL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|