C14H14F2N2 — CID 115211908
3-[[(2,4-difluorophenyl)methylamino]methyl]aniline (PubChem CID 115211908) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[[(2,4-difluorophenyl)methylamino]methyl]aniline.
| Compound Name | 3-[[(2,4-difluorophenyl)methylamino]methyl]aniline |
|---|---|
| PubChem CID | 115211908 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-[[(2,4-difluorophenyl)methylamino]methyl]aniline |
| SMILES | Nc1cccc(CNCc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H14F2N2/c15-12-5-4-11(14(16)7-12)9-18-8-10-2-1-3-13(17)6-10/h1-7,18H,8-9,17H2 |
| InChIKey | DEBKAKFGIQYUJY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|