C13H11F2N — CID 116925761
3-[(2,5-difluorophenyl)methyl]aniline (PubChem CID 116925761) has the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]aniline.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 116925761 |
| Molecular Formula | C13H11F2N |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]aniline |
| SMILES | Nc1cccc(Cc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C13H11F2N/c14-11-4-5-13(15)10(8-11)6-9-2-1-3-12(16)7-9/h1-5,7-8H,6,16H2 |
| InChIKey | BBMYBQCTVQSOJD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|