C14H15N — CID 116925822
3-[(2-methylphenyl)methyl]aniline (PubChem CID 116925822) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-[(2-methylphenyl)methyl]aniline.
| Compound Name | 3-[(2-methylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 116925822 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-[(2-methylphenyl)methyl]aniline |
| SMILES | Cc1ccccc1Cc1cccc(N)c1 |
| InChI | InChI=1S/C14H15N/c1-11-5-2-3-7-13(11)9-12-6-4-8-14(15)10-12/h2-8,10H,9,15H2,1H3 |
| InChIKey | BTUNJPJBGDTQEN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|