C31H36BrN — CID 159467395
2-bromo-1,4-dimethylbenzene;1,4-dimethyl-2-[(3-methylphenyl)methyl]benzene;3-methylaniline (PubChem CID 159467395) has the molecular formula C31H36BrN and a molecular weight of 502.54 g/mol. Its IUPAC name is 2-bromo-1,4-dimethylbenzene;1,4-dimethyl-2-[(3-methylphenyl)methyl]benzene;3-methylaniline.
| Compound Name | 2-bromo-1,4-dimethylbenzene;1,4-dimethyl-2-[(3-methylphenyl)methyl]benzene;3-methylaniline |
|---|---|
| PubChem CID | 159467395 |
| Molecular Formula | C31H36BrN |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-bromo-1,4-dimethylbenzene;1,4-dimethyl-2-[(3-methylphenyl)methyl]benzene;3-methylaniline |
| SMILES | Cc1ccc(C)c(Br)c1.Cc1cccc(Cc2cc(C)ccc2C)c1.Cc1cccc(N)c1 |
| InChI | InChI=1S/C16H18.C8H9Br.C7H9N/c1-12-5-4-6-15(9-12)11-16-10-13(2)7-8-14(16)3;1-6-3-4-7(2)8(9)5-6;1-6-3-2-4-7(8)5-6/h4-10H,11H2,1-3H3;3-5H,1-2H3;2-5H,8H2,1H3 |
| InChIKey | LVJBISLGVHWPRB-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|