C28H30N4 — CID 130251815
4-[[4-amino-3-[[3-amino-5-[(3-aminophenyl)methyl]phenyl]methyl]phenyl]methyl]-2-methylaniline (PubChem CID 130251815) has the molecular formula C28H30N4 and a molecular weight of 422.58 g/mol. Its IUPAC name is 4-[[4-amino-3-[[3-amino-5-[(3-aminophenyl)methyl]phenyl]methyl]phenyl]methyl]-2-methylaniline.
| Compound Name | 4-[[4-amino-3-[[3-amino-5-[(3-aminophenyl)methyl]phenyl]methyl]phenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 130251815 |
| Molecular Formula | C28H30N4 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 4-[[4-amino-3-[[3-amino-5-[(3-aminophenyl)methyl]phenyl]methyl]phenyl]methyl]-2-methylaniline |
| SMILES | Cc1cc(Cc2ccc(N)c(Cc3cc(N)cc(Cc4cccc(N)c4)c3)c2)ccc1N |
| InChI | InChI=1S/C28H30N4/c1-18-9-20(5-7-27(18)31)10-21-6-8-28(32)24(13-21)14-23-12-22(16-26(30)17-23)11-19-3-2-4-25(29)15-19/h2-9,12-13,15-17H,10-11,14,29-32H2,1H3 |
| InChIKey | XTJNFLNBSRXEAT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|