About 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane
4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane (PubChem CID 155059275) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane.
Molecular Properties
| Compound Name | 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane |
| PubChem CID | 155059275 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane |
| SMILES | Cc1cc(Cc2ccc(N)c(C)c2)ccc1N.N |
| InChI | InChI=1S/C15H18N2.H3N/c1-10-7-12(3-5-14(10)16)9-13-4-6-15(17)11(2)8-13;/h3-8H,9,16-17H2,1-2H3;1H3 |
| InChIKey | LIDWIKMMYWJKDT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane?
The IUPAC name of 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane (CID 155059275) is 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane.
What is the SMILES notation for 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane?
The canonical SMILES for 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane is Cc1cc(Cc2ccc(N)c(C)c2)ccc1N.N.
What is the InChIKey of 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane?
The InChIKey is LIDWIKMMYWJKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2.H3N/c1-10-7-12(3-5-14(10)16)9-13-4-6-15(17)11(2)8-13;/h3-8H,9,16-17H2,1-2H3;1H3.
What are the key properties of 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane?
4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane has a molecular weight of 243.35 g/mol, XLogP of 3.22, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline;azane is sourced from PubChem (CID 155059275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).