C14H13F2N3O — CID 62498968
1-[(3-aminophenyl)methyl]-3-(2,4-difluorophenyl)urea (PubChem CID 62498968) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(3-aminophenyl)methyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 62498968 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-3-(2,4-difluorophenyl)urea |
| SMILES | Nc1cccc(CNC(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H13F2N3O/c15-10-4-5-13(12(16)7-10)19-14(20)18-8-9-2-1-3-11(17)6-9/h1-7H,8,17H2,(H2,18,19,20) |
| InChIKey | AADAHULJUZXMSO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|