C14H14FN3S — CID 71670525
1-[(3-aminophenyl)methyl]-3-(2-fluorophenyl)thiourea (PubChem CID 71670525) has the molecular formula C14H14FN3S and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[(3-aminophenyl)methyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 71670525 |
| Molecular Formula | C14H14FN3S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-3-(2-fluorophenyl)thiourea |
| SMILES | Nc1cccc(CNC(=S)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C14H14FN3S/c15-12-6-1-2-7-13(12)18-14(19)17-9-10-4-3-5-11(16)8-10/h1-8H,9,16H2,(H2,17,18,19) |
| InChIKey | WPZUINXORWGBPR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|