C14H16FN3S — CID 8769095
1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(2-fluorophenyl)thiourea (PubChem CID 8769095) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8769095 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-(2-fluorophenyl)thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2ccccc2F)n1C |
| InChI | InChI=1S/C14H16FN3S/c1-10-7-8-11(18(10)2)9-16-14(19)17-13-6-4-3-5-12(13)15/h3-8H,9H2,1-2H3,(H2,16,17,19) |
| InChIKey | JBUDVXTZLZNBLS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|