C15H17FN2 — CID 115211996
3-[[2-(2-fluorophenyl)ethylamino]methyl]aniline (PubChem CID 115211996) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)ethylamino]methyl]aniline.
| Compound Name | 3-[[2-(2-fluorophenyl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 115211996 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)ethylamino]methyl]aniline |
| SMILES | Nc1cccc(CNCCc2ccccc2F)c1 |
| InChI | InChI=1S/C15H17FN2/c16-15-7-2-1-5-13(15)8-9-18-11-12-4-3-6-14(17)10-12/h1-7,10,18H,8-9,11,17H2 |
| InChIKey | YHWKYMVMKCYQIM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|