C18H18FN3S — CID 23286918
2-[4-[[(3-fluorophenyl)methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine (PubChem CID 23286918) has the molecular formula C18H18FN3S and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[4-[[(3-fluorophenyl)methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine.
| Compound Name | 2-[4-[[(3-fluorophenyl)methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 23286918 |
| Molecular Formula | C18H18FN3S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[4-[[(3-fluorophenyl)methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(-c2cscc2CNCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H18FN3S/c19-14-3-1-2-12(6-14)8-22-9-13-10-23-11-17(13)16-7-15(20)4-5-18(16)21/h1-7,10-11,22H,8-9,20-21H2 |
| InChIKey | KUDGJHRFHDMXEN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|