C19H18F3N3S — CID 23286899
2-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine (PubChem CID 23286899) has the molecular formula C19H18F3N3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine.
| Compound Name | 2-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 23286899 |
| Molecular Formula | C19H18F3N3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]thiophen-3-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(-c2cscc2CNCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H18F3N3S/c20-19(21,22)14-3-1-12(2-4-14)8-25-9-13-10-26-11-17(13)16-7-15(23)5-6-18(16)24/h1-7,10-11,25H,8-9,23-24H2 |
| InChIKey | MMOGFTSEMVWYOT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|