C24H41N5 — CID 139658951
2,4,6-tris(piperidin-1-ylmethyl)benzene-1,3-diamine (PubChem CID 139658951) has the molecular formula C24H41N5 and a molecular weight of 399.63 g/mol. Its IUPAC name is 2,4,6-tris(piperidin-1-ylmethyl)benzene-1,3-diamine.
| Compound Name | 2,4,6-tris(piperidin-1-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 139658951 |
| Molecular Formula | C24H41N5 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.34 |
| IUPAC Name | 2,4,6-tris(piperidin-1-ylmethyl)benzene-1,3-diamine |
| SMILES | Nc1c(CN2CCCCC2)cc(CN2CCCCC2)c(N)c1CN1CCCCC1 |
| InChI | InChI=1S/C24H41N5/c25-23-20(17-27-10-4-1-5-11-27)16-21(18-28-12-6-2-7-13-28)24(26)22(23)19-29-14-8-3-9-15-29/h16H,1-15,17-19,25-26H2 |
| InChIKey | JSSILYHXPBVCNS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|