C11H18ClN3 — CID 22328120
4-(pyrrolidin-1-ylmethyl)benzene-1,3-diamine;hydrochloride (PubChem CID 22328120) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-(pyrrolidin-1-ylmethyl)benzene-1,3-diamine;hydrochloride.
| Compound Name | 4-(pyrrolidin-1-ylmethyl)benzene-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 22328120 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(pyrrolidin-1-ylmethyl)benzene-1,3-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(CN2CCCC2)c(N)c1 |
| InChI | InChI=1S/C11H17N3.ClH/c12-10-4-3-9(11(13)7-10)8-14-5-1-2-6-14;/h3-4,7H,1-2,5-6,8,12-13H2;1H |
| InChIKey | OQSMGTMOUOGFRA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|