C10H14N2O — CID 130546739
4-amino-2-(azetidin-1-ylmethyl)phenol (PubChem CID 130546739) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-amino-2-(azetidin-1-ylmethyl)phenol.
| Compound Name | 4-amino-2-(azetidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 130546739 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-amino-2-(azetidin-1-ylmethyl)phenol |
| SMILES | Nc1ccc(O)c(CN2CCC2)c1 |
| InChI | InChI=1S/C10H14N2O/c11-9-2-3-10(13)8(6-9)7-12-4-1-5-12/h2-3,6,13H,1,4-5,7,11H2 |
| InChIKey | FBDJFGQVGBVGNF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|