C13H20N2O2 — CID 43375473
4-amino-2-[(2,6-dimethylmorpholin-4-yl)methyl]phenol (PubChem CID 43375473) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-amino-2-[(2,6-dimethylmorpholin-4-yl)methyl]phenol.
| Compound Name | 4-amino-2-[(2,6-dimethylmorpholin-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 43375473 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 4-amino-2-[(2,6-dimethylmorpholin-4-yl)methyl]phenol |
| SMILES | CC1CN(Cc2cc(N)ccc2O)CC(C)O1 |
| InChI | InChI=1S/C13H20N2O2/c1-9-6-15(7-10(2)17-9)8-11-5-12(14)3-4-13(11)16/h3-5,9-10,16H,6-8,14H2,1-2H3 |
| InChIKey | UEKDYCSYWMCJMV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|