C15H25N3O3 — CID 155403079
4-amino-2-[[4-(2,2-dimethoxyethyl)piperazin-1-yl]methyl]phenol (PubChem CID 155403079) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-amino-2-[[4-(2,2-dimethoxyethyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 4-amino-2-[[4-(2,2-dimethoxyethyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 155403079 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-amino-2-[[4-(2,2-dimethoxyethyl)piperazin-1-yl]methyl]phenol |
| SMILES | COC(CN1CCN(Cc2cc(N)ccc2O)CC1)OC |
| InChI | InChI=1S/C15H25N3O3/c1-20-15(21-2)11-18-7-5-17(6-8-18)10-12-9-13(16)3-4-14(12)19/h3-4,9,15,19H,5-8,10-11,16H2,1-2H3 |
| InChIKey | QYJUNLCENSVPQL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|