C26H38N2O2 — CID 1098143
4-tert-butyl-2-[[4-[(5-tert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol (PubChem CID 1098143) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 4-tert-butyl-2-[[4-[(5-tert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol.
| Compound Name | 4-tert-butyl-2-[[4-[(5-tert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 1098143 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 4-tert-butyl-2-[[4-[(5-tert-butyl-2-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(CN2CCN(Cc3cc(C(C)(C)C)ccc3O)CC2)c1 |
| InChI | InChI=1S/C26H38N2O2/c1-25(2,3)21-7-9-23(29)19(15-21)17-27-11-13-28(14-12-27)18-20-16-22(26(4,5)6)8-10-24(20)30/h7-10,15-16,29-30H,11-14,17-18H2,1-6H3 |
| InChIKey | GPWSYMDQFUVVMK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|