C19H30N2O3 — CID 95708185
4-tert-butyl-2-[[(6R)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methyl]phenol (PubChem CID 95708185) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-tert-butyl-2-[[(6R)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methyl]phenol.
| Compound Name | 4-tert-butyl-2-[[(6R)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methyl]phenol |
|---|---|
| PubChem CID | 95708185 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 4-tert-butyl-2-[[(6R)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methyl]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(CN2CCO[C@]3(CNCCOC3)C2)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-18(2,3)16-4-5-17(22)15(10-16)11-21-7-9-24-19(13-21)12-20-6-8-23-14-19/h4-5,10,20,22H,6-9,11-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | AWZZADHGQZLIFO-LJQANCHMSA-N |
| XLogP | 1.88 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|