C26H34N2O2 — CID 46241970
4-[(Z)-3-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(pyrrolidin-1-ylmethyl)phenol (PubChem CID 46241970) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[(Z)-3-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(pyrrolidin-1-ylmethyl)phenol.
| Compound Name | 4-[(Z)-3-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(pyrrolidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 46241970 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 4-[(Z)-3-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(pyrrolidin-1-ylmethyl)phenol |
| SMILES | C/C(=C(\C)c1ccc(O)c(CN2CCCC2)c1)c1ccc(O)c(CN2CCCC2)c1 |
| InChI | InChI=1S/C26H34N2O2/c1-19(21-7-9-25(29)23(15-21)17-27-11-3-4-12-27)20(2)22-8-10-26(30)24(16-22)18-28-13-5-6-14-28/h7-10,15-16,29-30H,3-6,11-14,17-18H2,1-2H3/b20-19- |
| InChIKey | IJTXFIMJEJTXNH-VXPUYCOJSA-N |
| XLogP | 5.24 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|