C12H17Cl2NO — CID 15576412
4-chloro-2-(piperidin-1-ylmethyl)phenol;hydrochloride (PubChem CID 15576412) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is 4-chloro-2-(piperidin-1-ylmethyl)phenol;hydrochloride.
| Compound Name | 4-chloro-2-(piperidin-1-ylmethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 15576412 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-chloro-2-(piperidin-1-ylmethyl)phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Cl)cc1CN1CCCCC1 |
| InChI | InChI=1S/C12H16ClNO.ClH/c13-11-4-5-12(15)10(8-11)9-14-6-2-1-3-7-14;/h4-5,8,15H,1-3,6-7,9H2;1H |
| InChIKey | GWQNOPFMSZTEAI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|