C26H28ClNO2 — CID 92858021
(2Z,6E)-2-[(4-chlorophenyl)methylidene]-6-[[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]methylidene]cyclohexan-1-one (PubChem CID 92858021) has the molecular formula C26H28ClNO2 and a molecular weight of 421.97 g/mol. Its IUPAC name is (2Z,6E)-2-[(4-chlorophenyl)methylidene]-6-[[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2Z,6E)-2-[(4-chlorophenyl)methylidene]-6-[[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 92858021 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (2Z,6E)-2-[(4-chlorophenyl)methylidene]-6-[[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]methylidene]cyclohexan-1-one |
| SMILES | O=C1/C(=C\c2ccc(Cl)cc2)CCC/C1=C\c1ccc(O)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C26H28ClNO2/c27-24-10-7-19(8-11-24)15-21-5-4-6-22(26(21)30)16-20-9-12-25(29)23(17-20)18-28-13-2-1-3-14-28/h7-12,15-17,29H,1-6,13-14,18H2/b21-15-,22-16+ |
| InChIKey | VGGDXIXJVYYRAS-KBNZVFGVSA-N |
| XLogP | 6.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|