C33H42N2O5 — CID 155927722
(2E,5E)-2,5-bis[[4-hydroxy-3-methoxy-5-(piperidin-1-ylmethyl)phenyl]methylidene]cyclopentan-1-one (PubChem CID 155927722) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[[4-hydroxy-3-methoxy-5-(piperidin-1-ylmethyl)phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[[4-hydroxy-3-methoxy-5-(piperidin-1-ylmethyl)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 155927722 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (2E,5E)-2,5-bis[[4-hydroxy-3-methoxy-5-(piperidin-1-ylmethyl)phenyl]methylidene]cyclopentan-1-one |
| SMILES | COc1cc(/C=C2\CC/C(=C\c3cc(CN4CCCCC4)c(O)c(OC)c3)C2=O)cc(CN2CCCCC2)c1O |
| InChI | InChI=1S/C33H42N2O5/c1-39-29-19-23(17-27(32(29)37)21-34-11-5-3-6-12-34)15-25-9-10-26(31(25)36)16-24-18-28(33(38)30(20-24)40-2)22-35-13-7-4-8-14-35/h15-20,37-38H,3-14,21-22H2,1-2H3/b25-15+,26-16+ |
| InChIKey | OMTIHHABIXWYPY-RYQLWAFASA-N |
| XLogP | 5.92 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|