C22H30N2O6 — CID 67916657
2-[[3-[(2-hydroxy-3,5-dimethoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4,6-dimethoxyphenol (PubChem CID 67916657) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-3,5-dimethoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4,6-dimethoxyphenol.
| Compound Name | 2-[[3-[(2-hydroxy-3,5-dimethoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4,6-dimethoxyphenol |
|---|---|
| PubChem CID | 67916657 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-[[3-[(2-hydroxy-3,5-dimethoxyphenyl)methyl]-1,3-diazinan-1-yl]methyl]-4,6-dimethoxyphenol |
| SMILES | COc1cc(CN2CCCN(Cc3cc(OC)cc(OC)c3O)C2)c(O)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O6/c1-27-17-8-15(21(25)19(10-17)29-3)12-23-6-5-7-24(14-23)13-16-9-18(28-2)11-20(30-4)22(16)26/h8-11,25-26H,5-7,12-14H2,1-4H3 |
| InChIKey | ZQINZYTZLDBQPT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|